|
|
| | 3-(N-Acetylamino)-5-(N-decyl-N-methylamino)benzyl alcohol Basic information |
| Product Name: | 3-(N-Acetylamino)-5-(N-decyl-N-methylamino)benzyl alcohol | | Synonyms: | 3-(N-ACETYLAMINO)-5-(N-DECYL-N-METHYLAMI NO)BENZYL;ADMB;N-[3-[decyl(methyl)amino]-5-(hydroxymethyl)phenyl]acetamide;Acetamide, N-[3-(decylmethylamino)-5-(hydroxymethyl)phenyl]-;3-(N-Acetylamino)-5-(N-decyl-N-methylamino)benzyl alcohol;3-(N-Acetylamino)-5-(N-decyl-N-methylamino)benzyl alcohol | | CAS: | 103955-90-4 | | MF: | C20H34N2O2 | | MW: | 334.5 | | EINECS: | | | Product Categories: | | | Mol File: | 103955-90-4.mol |  |
| | 3-(N-Acetylamino)-5-(N-decyl-N-methylamino)benzyl alcohol Chemical Properties |
| Boiling point | 536.6±50.0 °C(Predicted) | | density | 1.035±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.47±0.10(Predicted) | | Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary | | InChI | 1S/C20H34N2O2/c1-4-5-6-7-8-9-10-11-12-22(3)20-14-18(16-23)13-19(15-20)21-17(2)24/h13-15,23H,4-12,16H2,1-3H3,(H,21,24) | | InChIKey | YGFQCJGXLSFQPL-UHFFFAOYSA-N | | SMILES | CCCCCCCCCCN(C)c1cc(CO)cc(NC(C)=O)c1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3-(N-Acetylamino)-5-(N-decyl-N-methylamino)benzyl alcohol Usage And Synthesis |
| Uses | 3-(N-Acetylamino)-5-(N-decyl-N-methylamino)benzyl Alcohol is a synthetic protein kinase C and protein kinase A activator. | | Biological Activity | A designed activator of protein kinase C shown to increase the surface expression of the tumor-associated antigen BCA 225 and various cellular antigens in T47D cells. |
| | 3-(N-Acetylamino)-5-(N-decyl-N-methylamino)benzyl alcohol Preparation Products And Raw materials |
|