- 2-Butylbenzofuran
-
- $0.00 / 1kg
-
2026-03-31
- CAS:4265-27-4
- Min. Order: 0.001kg
- Purity: 99%
- Supply Ability: 200000T
- 2-Butylbenzofuran
-
- $0.00 / 1g
-
2026-03-31
- CAS:4265-27-4
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 1000000T
- 2-Butylbenzofuran
-
- $0.00 / 1KG
-
2026-03-31
- CAS:4265-27-4
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | 2-Butylbenzofuran Basic information |
| Product Name: | 2-Butylbenzofuran | | Synonyms: | 2-BUTYLBENZOFURAN;2-N-BUTYLBENZO[B]FURAN;2-N-BUTYLBENZOFURAN;2-butyl-benzofura;2-Buthylbenzo【b】furan;2-Butylbenzofurane;2-Butyl;Benzofuran, 2-butyl- | | CAS: | 4265-27-4 | | MF: | C12H14O | | MW: | 174.24 | | EINECS: | 224-250-7 | | Product Categories: | 4265-27-4 | | Mol File: | 4265-27-4.mol |  |
| | 2-Butylbenzofuran Chemical Properties |
| Boiling point | 114-116°C 8mm | | density | 0,987 g/cm3 | | refractive index | 1.5330 | | Fp | 101°C | | form | clear liquid | | color | Light yellow to Yellow | | Specific Gravity | 0.987 | | BRN | 1365111 | | InChI | InChI=1S/C12H14O/c1-2-3-7-11-9-10-6-4-5-8-12(10)13-11/h4-6,8-9H,2-3,7H2,1H3 | | InChIKey | OVJKFJDEVKABNF-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2C=C1CCCC | | CAS DataBase Reference | 4265-27-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 2932990090 |
| Provider | Language |
|
ALFA
| English |
| | 2-Butylbenzofuran Usage And Synthesis |
| Chemical Properties | Liquid. Boiling point 129°C/2.0kPa (15mmHg), relative density 0.987, refractive index 1.5330, flash point 101°C. | | Uses | 2-Butylbenzofuran is used in process for prepn. of Amiodarone key intermediate 2-butyl-3-(3,5-diiodo-4-hydroxybenzoyl)benzofuran. |
| | 2-Butylbenzofuran Preparation Products And Raw materials |
|