| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
RYSS TECH LTD |
| Tel: |
400-188-0725 +86 21 34310725 13611771617 |
| Email: |
|
4-Nitrophenyl phosphorodichloridate manufacturers
|
| | 4-Nitrophenyl phosphorodichloridate Basic information |
| Product Name: | 4-Nitrophenyl phosphorodichloridate | | Synonyms: | phosphorodichloridicacid,4-nitrophenylester;4-nitrophenyl dichlorophosphonate;4-Nitrophenylphosphorodichloridate,97%;Dichloridophosphoric acid p-nitrophenyl;Dichloridophosphoric acid p-nitrophenyl ester;Dichlorophosphinic acid=p-nitrophenyl ester;Dichloridophosphoric Acid P-Nitrop;1-dichlorophosphoryloxy-4-nitrobenzene | | CAS: | 777-52-6 | | MF: | C6H4Cl2NO4P | | MW: | 255.98 | | EINECS: | 212-289-2 | | Product Categories: | | | Mol File: | 777-52-6.mol |  |
| | 4-Nitrophenyl phosphorodichloridate Chemical Properties |
| Melting point | 44-45 °C (lit.) | | Boiling point | 182-183 °C/13 mmHg (lit.) | | density | 1.644 | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly) | | form | solid | | BRN | 1468239 | | Stability: | Hygroscopic, Moisture Sensitive | | InChI | InChI=1S/C6H4Cl2NO4P/c7-14(8,12)13-6-3-1-5(2-4-6)9(10)11/h1-4H | | InChIKey | NCPBESHYZRJICR-UHFFFAOYSA-N | | SMILES | P(Cl)(Cl)(OC1=CC=C([N+]([O-])=O)C=C1)=O | | EPA Substance Registry System | Phosphorodichloridic acid, 4-nitrophenyl ester (777-52-6) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-Nitrophenyl phosphorodichloridate Usage And Synthesis |
| Uses | 4-Nitrophenyl phosphorodichloridate was used to phosphorylate the derivatized resin. | | Application | 4-Nitrophenyl Phosphorodichloridate is used as a reagent in the synthesis of dihydrobenzodioxaphosphocine oxide derivatives which have antioxidant activity. |
| | 4-Nitrophenyl phosphorodichloridate Preparation Products And Raw materials |
|