| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid Basic information |
| | 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | InChI | 1S/C11H15BFNO3/c1-3-14(4-2)11(15)8-5-9(12(16)17)7-10(13)6-8/h5-7,16-17H,3-4H2,1-2H3 | | InChIKey | PWFQDNPXVAYCOK-UHFFFAOYSA-N | | SMILES | CCN(CC)C(=O)c1cc(F)cc(c1)B(O)O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid Usage And Synthesis |
| | 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid Preparation Products And Raw materials |
|