| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Aceschem Inc. |
| Tel: |
+1-817863-6948 +1-（817）863-6948 |
| Email: |
sales@aceschem.com |
|
| | 4-(1H,1H,2H,2H-Perfluordecylthio)-phenol Basic information |
| Product Name: | 4-(1H,1H,2H,2H-Perfluordecylthio)-phenol | | Synonyms: | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-HEPTADECAFLUORODECYLTHIO)PHENOL;4-(1H,1H,2H,2H-PERFLUORODECYL-1-THIO)-PHENOL;FluoMar;FluoMarTM, 4-(1H,1H,2H,2H-Perfluordecylthio)-phenol;Phenol, 4-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)thio]-;4-(1H,1H,2H,2H-Perfluordecylthio)-phenol | | CAS: | 142623-70-9 | | MF: | C16H9F17OS | | MW: | 572.28 | | EINECS: | | | Product Categories: | | | Mol File: | 142623-70-9.mol |  |
| | 4-(1H,1H,2H,2H-Perfluordecylthio)-phenol Chemical Properties |
| Melting point | 90-95 °C | | Boiling point | 346.1±42.0 °C(Predicted) | | density | 1.62±0.1 g/cm3(Predicted) | | pka | 9.66±0.26(Predicted) | | InChI | 1S/C16H9F17OS/c17-9(18,5-6-35-8-3-1-7(34)2-4-8)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h1-4,34H,5-6H2 | | InChIKey | HNEIKMUHLLYTLP-UHFFFAOYSA-N | | SMILES | Oc1ccc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 | | EPA Substance Registry System | 4-(1H,1H,2H,2H-Perfluorodecylthio)phenol (142623-70-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | F | 10-23 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| | 4-(1H,1H,2H,2H-Perfluordecylthio)-phenol Usage And Synthesis |
| | 4-(1H,1H,2H,2H-Perfluordecylthio)-phenol Preparation Products And Raw materials |
|