|
|
| | Licoisoflavanone Basic information |
| Product Name: | Licoisoflavanone | | Synonyms: | Licoisoflavanone;5,5',7-Trihydroxy-2',2'-dimethyl-[3,6'-bi-2H-1-benzopyran]-4(3H)-one;[3,6'-Bi-2H-1-benzopyran]-4(3H)-one, 5,5',7-trihydroxy-2',2'-dimethyl-;5,7-dihydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)-2,3-dihydrochromen-4-one | | CAS: | 66067-26-3 | | MF: | C20H18O6 | | MW: | 354.35 | | EINECS: | | | Product Categories: | | | Mol File: | 66067-26-3.mol |  |
| | Licoisoflavanone Chemical Properties |
| Boiling point | 551.1±50.0 °C(Predicted) | | density | 1.401±0.06 g/cm3(Predicted) | | pka | 7.49±0.40(Predicted) | | InChI | InChI=1S/C20H18O6/c1-20(2)6-5-12-15(26-20)4-3-11(18(12)23)13-9-25-16-8-10(21)7-14(22)17(16)19(13)24/h3-8,13,21-23H,9H2,1-2H3 | | InChIKey | JNDPLDZUOFZXIG-UHFFFAOYSA-N | | SMILES | C1OC2=CC(O)=CC(O)=C2C(=O)C1C1C(O)=C2C(=CC=1)OC(C)(C)C=C2 |
| | Licoisoflavanone Usage And Synthesis |
| Uses | Licoisoflavanone is the isoflavonoid compound isolated from Sinkiang licorice root (Glycyrrhiza)[1]. | | References | [1] Saitoh, Tamotsu, et al. Chemical studies on the Oriental plant drugs. XLIV. A new isoflavone and the corresponding isoflavanone of licorice root. |
| | Licoisoflavanone Preparation Products And Raw materials |
|