|
|
| | OTAVA-BB 7020400386 Basic information |
| | OTAVA-BB 7020400386 Chemical Properties |
| form | solid | | InChI | 1S/C11H10O4/c12-11(13)4-2-8-1-3-9-10(7-8)15-6-5-14-9/h1-4,7H,5-6H2,(H,12,13)/b4-2+ | | InChIKey | KPDOZWMLNDDCDJ-DUXPYHPUSA-N | | SMILES | O1CCOc2c1cc(cc2)\C=C\C(=O)O |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | OTAVA-BB 7020400386 Usage And Synthesis |
| | OTAVA-BB 7020400386 Preparation Products And Raw materials |
|