7-Bromo-2-chloro-3-methylquinoline manufacturers
|
| | 7-Bromo-2-chloro-3-methylquinoline Basic information |
| | 7-Bromo-2-chloro-3-methylquinoline Chemical Properties |
| Boiling point | 342.2±37.0 °C(Predicted) | | density | 1.591±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -1.09±0.50(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C10H7BrClN/c1-6-4-7-2-3-8(11)5-9(7)13-10(6)12/h2-5H,1H3 | | InChIKey | SQFVOHFUJOPVEH-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(Br)C=2)C=C(C)C=1Cl |
| Risk Statements | 41 | | Safety Statements | 26-39 | | HS Code | 2933499090 |
| | 7-Bromo-2-chloro-3-methylquinoline Usage And Synthesis |
| | 7-Bromo-2-chloro-3-methylquinoline Preparation Products And Raw materials |
|