| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-Benzyladenine Basic information | | Uses |
| | 3-Benzyladenine Chemical Properties |
| Melting point | 268-275 °C | | Boiling point | 373.4±52.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.54±0.20(Predicted) | | color | White to Off-White | | InChI | 1S/C12H11N5/c13-11-10-12(15-7-14-10)17(8-16-11)6-9-4-2-1-3-5-9/h1-5,7-8H,6,13H2 | | InChIKey | ZRRXJVVXTVXDII-UHFFFAOYSA-N | | SMILES | Nc1ncn(Cc2ccccc2)c3ncnc13 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Repr. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Benzyladenine Usage And Synthesis |
| Uses | 3-Benzyladenine can be prepared by a one-step reaction of adenine and benzyl bromide, and it can be used as a pharmaceutical intermediate. |
| | 3-Benzyladenine Preparation Products And Raw materials |
|