| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate Basic information |
| | [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate Chemical Properties |
| Melting point | 85-90℃ | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C9H11F3NOS.BF4/c1-13(2)15(14,9(10,11)12)8-6-4-3-5-7-8;2-1(3,4)5/h3-7H,1-2H3;/q+1;-1 | | InChIKey | JQIUQSKIGNTITL-UHFFFAOYSA-N | | SMILES | F[B-](F)(F)F.C[N+](C)=S(=O)(c1ccccc1)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | UN 1759 8/PG III | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate Usage And Synthesis |
| Uses | Reagent for the preparation of monofluoromethyl esters and ethers |
| | [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate Preparation Products And Raw materials |
|