| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Diphenylacetylene-4,4'-diboronic acid bis(pinacol) ester, 95% Basic information |
| Product Name: | Diphenylacetylene-4,4'-diboronic acid bis(pinacol) ester, 95% | | Synonyms: | 4,4,5,5-Tetramethyl-2-(4-{2-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl}phenyl)-1,3,2-dioxaborolane;1,2-Bis(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetylene;4,4′-(Acetylene-1,2-diyl)bis(phenylboronic acid pinacol ester);4,4,5,5-Tetramethyl-2-(4-{2-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl}phenyl)-1,3;4,4'-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)DIPHENYLACETYLENE;4,4,5,5-tetramethyl-2-[4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]phenyl]-1,3,2-dioxaborolane;4,4,5,5-Tetramethyl-2-(4-{2-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl}phenyl)-1,3,2-;Bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetylene | | CAS: | 849681-64-7 | | MF: | C26H32B2O4 | | MW: | 430.15 | | EINECS: | | | Product Categories: | | | Mol File: | 849681-64-7.mol |  |
| | Diphenylacetylene-4,4'-diboronic acid bis(pinacol) ester, 95% Chemical Properties |
| Melting point | 275-280°C | | Boiling point | 536.4±35.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | form | solid | | InChI | 1S/C26H32B2O4/c1-23(2)24(3,4)30-27(29-23)21-15-11-19(12-16-21)9-10-20-13-17-22(18-14-20)28-31-25(5,6)26(7,8)32-28/h11-18H,1-8H3 | | InChIKey | QJTLCFKOLMALPJ-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccc(cc2)C#Cc3ccc(cc3)B4OC(C)(C)C(C)(C)O4 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | Diphenylacetylene-4,4'-diboronic acid bis(pinacol) ester, 95% Usage And Synthesis |
| Uses | 4,4''-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)diphenylacetylene |
| | Diphenylacetylene-4,4'-diboronic acid bis(pinacol) ester, 95% Preparation Products And Raw materials |
|