|
|
| | Bis(4-bromophenyl)acetylene Basic information |
| | Bis(4-bromophenyl)acetylene Chemical Properties |
| Melting point | 182 °C | | Boiling point | 383.6±27.0 °C(Predicted) | | density | 1.74±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Ethyl Acetate (Sparingly) | | form | Crystalline Powder | | color | Off-white | | InChI | InChI=1S/C14H8Br2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h3-10H | | InChIKey | FJQGIJIHOXZMMJ-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)C=C1)#CC1=CC=C(Br)C=C1 |
| | Bis(4-bromophenyl)acetylene Usage And Synthesis |
| Chemical Properties | Off-white crystalline powder | | Uses | Bis(4-bromophenyl)acetylene is used as a reactant in the synthesis of ethynylarene analogs containing 2-(1,2,3-triazol-4-yl)pyridine as selective ''turn-on'' fluorescent chemosensors for Ni(II). |
| | Bis(4-bromophenyl)acetylene Preparation Products And Raw materials |
|