| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-CHLORO-2,5-DIMETHYLANILINE manufacturers
|
| | 4-CHLORO-2,5-DIMETHYLANILINE Basic information |
| Product Name: | 4-CHLORO-2,5-DIMETHYLANILINE | | Synonyms: | 4-CHLORO-2,5-DIMETHYLANILINE;4-Chloro-2,5-dimethylphenylamine;4-Chloro-2,5-diMethylaniline, 97+%;Benzenamine, 4-chloro-2,5-dimethyl-;4-Chloro-2,5-xylidine;4-Chloro-2,5-dimethylbenzenamine;2,5-dimethyl-4-chloroaniline | | CAS: | 20782-94-9 | | MF: | C8H10ClN | | MW: | 155.62 | | EINECS: | | | Product Categories: | | | Mol File: | 20782-94-9.mol |  |
| | 4-CHLORO-2,5-DIMETHYLANILINE Chemical Properties |
| Melting point | 94 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C8H10ClN/c1-5-4-8(10)6(2)3-7(5)9/h3-4H,10H2,1-2H3 | | InChIKey | POEANWWEPFQEEF-UHFFFAOYSA-N | | SMILES | C1(N)=CC(C)=C(Cl)C=C1C |
| Hazard Codes | Xi | | RIDADR | UN2811 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2921490090 |
| | 4-CHLORO-2,5-DIMETHYLANILINE Usage And Synthesis |
| | 4-CHLORO-2,5-DIMETHYLANILINE Preparation Products And Raw materials |
|