|
|
| | (4'-Propyl[1,1'-biphenyl]-4-yl)-boronic acid Basic information |
| Product Name: | (4'-Propyl[1,1'-biphenyl]-4-yl)-boronic acid | | Synonyms: | (4'-Propyl[1,1'-biphenyl]-4-yl)-boronic acid;4'-Propyl-4-biphenylboronic Acid (contains varying amounts of Anhydride);4'-n-propyl-4-biphenylboronic acid;(4'-Propyl-[1,1'-biphenyl]-4-yl);4'-Propylbiphenyl-4-boronic Acid;4'-Alkyl-4-biphenylboronic acid;Boronic acid, B-(4'-propyl[1,1'-biphenyl]-4-yl)-;[4-(4-propylphenyl)phenyl]boronic acid | | CAS: | 153035-56-4 | | MF: | C15H17BO2 | | MW: | 240.11 | | EINECS: | | | Product Categories: | | | Mol File: | 153035-56-4.mol | ![(4'-Propyl[1,1'-biphenyl]-4-yl)-boronic acid Structure](CAS2/GIF/153035-56-4.gif) |
| | (4'-Propyl[1,1'-biphenyl]-4-yl)-boronic acid Chemical Properties |
| Boiling point | 413.1±48.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 8.61±0.17(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C15H17BO2/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h4-11,17-18H,2-3H2,1H3 | | InChIKey | NOQFUISBLHCDSR-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C2=CC=C(CCC)C=C2)C=C1)(O)O |
| | (4'-Propyl[1,1'-biphenyl]-4-yl)-boronic acid Usage And Synthesis |
| Uses | 4''-Propyl-4-biphenylboronic acid |
| | (4'-Propyl[1,1'-biphenyl]-4-yl)-boronic acid Preparation Products And Raw materials |
|