|
|
| | 1H-BENZIMIDAZOLE-2-SULFONIC ACID Basic information |
| | 1H-BENZIMIDAZOLE-2-SULFONIC ACID Chemical Properties |
| Melting point | 116-119 °C(lit.) | | density | 1.4876 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | -1.47±0.40(Predicted) | | color | Off-White to Pale Beige | | InChI | 1S/C7H6N2O3S/c10-13(11,12)7-8-5-3-1-2-4-6(5)9-7/h1-4H,(H,8,9)(H,10,11,12) | | InChIKey | GWXQTTKUYBEZBP-UHFFFAOYSA-N | | SMILES | OS(=O)(=O)c1nc2ccccc2[nH]1 | | CAS DataBase Reference | 40828-54-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 1H-BENZIMIDAZOLE-2-SULFONIC ACID Usage And Synthesis |
| Chemical Properties | white to light beige crystalline powder | | Uses | Benzimidazole 2-Sulfonic Acid is a versatile reactant used in the preparation of bis(benzimidazol-2-yl)amines with antitrichinellosis activity. | | General Description | 1H-Benzimidazole-2-sulfonic acid (BISA) is a glutamate racemase (GR) inhibitor. It is a promising candidate for developing antibacterial drugs. BISA can be prepared by the oxidation of 1H-benzimidazole-2-thiol using hydrogen peroxide in the presence of potassium hydroxide. |
| | 1H-BENZIMIDAZOLE-2-SULFONIC ACID Preparation Products And Raw materials |
|