|
|
| | 2,6-diazaspiro[3.4]octan-7-one Basic information |
| | 2,6-diazaspiro[3.4]octan-7-one Chemical Properties |
| Boiling point | 349.8±42.0 °C(Predicted) | | density | 1.21 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 16.19±0.20(Predicted) | | InChI | InChI=1S/C6H10N2O/c9-5-1-6(4-8-5)2-7-3-6/h7H,1-4H2,(H,8,9) | | InChIKey | GZTLCSVTDYAMCZ-UHFFFAOYSA-N | | SMILES | C1C2(CC(=O)NC2)CN1 |
| | 2,6-diazaspiro[3.4]octan-7-one Usage And Synthesis |
| Uses | 2,6-Diaza-spiro[3.4]octan-7-one is used as a reactant in the preparation of indolylacetamides as autotaxin inhibitors useful in treating diseases. |
| | 2,6-diazaspiro[3.4]octan-7-one Preparation Products And Raw materials |
|