| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 6-Oxa-1-aza-spiro[3,3]heptane-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | 6-Oxa-1-aza-spiro[3,3]heptane-1-carboxylic acid tert-butyl ester | | Synonyms: | 6-Oxa-1-aza-spiro[3,3]heptane-1-carboxylic acid tert-butyl ester;6-Oxa-1-azaspiro[3.3]heptane-1-carboxylic acid, 1,1-diMethylethyl ester;1-Boc-6-oxa-1-azaspiro[3.3]heptane, 95%;1,1-Dimethylethyl 6-oxa-1-azaspiro[3.3]heptane-1-carboxylate;1-Boc-6-oxa-1-azaspiro[3.3]heptane;6-Oxa-1-azaspiro[3.3]heptane-1-carboxylic acid tert-butyl ester 95+% | | CAS: | 1245816-27-6 | | MF: | C10H17NO3 | | MW: | 199.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1245816-27-6.mol | ![6-Oxa-1-aza-spiro[3,3]heptane-1-carboxylic acid tert-butyl ester Structure](CAS/GIF/1245816-27-6.gif) |
| | 6-Oxa-1-aza-spiro[3,3]heptane-1-carboxylic acid tert-butyl ester Chemical Properties |
| Melting point | 33-40°C | | Fp | >110℃ | | storage temp. | -20°C | | form | solid | | Appearance | white solid | | InChI | 1S/C10H17NO3/c1-9(2,3)14-8(12)11-5-4-10(11)6-13-7-10/h4-7H2,1-3H3 | | InChIKey | FIFKIIBTYOOVJD-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCC12COC2 |
| Risk Statements | 52 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | 6-Oxa-1-aza-spiro[3,3]heptane-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| | 6-Oxa-1-aza-spiro[3,3]heptane-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|