|
|
| | 6-Oxa-1-azaspiro[3.3]heptane oxalate(2:1) Basic information |
| | 6-Oxa-1-azaspiro[3.3]heptane oxalate(2:1) Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/2C5H9NO.C2H2O4/c2*1-2-6-5(1)3-7-4-5;3-1(4)2(5)6/h2*6H,1-4H2;(H,3,4)(H,5,6) | | InChIKey | UMKDEMSXCWMHRS-UHFFFAOYSA-N | | SMILES | O=C(C(=O)O)O.N1C2(COC2)CC1.N1C2(COC2)CC1 |
| | 6-Oxa-1-azaspiro[3.3]heptane oxalate(2:1) Usage And Synthesis |
| Uses | 6-Oxa-1-azaspiro[3.3]heptane oxalate(2:1) can be used in pharmaceutical synthesis and scientific research.
| | Synthesis | In the work of Alexander A. Kirichok and colleagues, 1-Azaspiro[3.3]heptanes were synthesized, characterized, and validated biologically as bioisosteres of piperidine.[1] | | References | [1] ALEXANDER A. KIRICHOK. 1-Azaspiro[3.3]heptane as a Bioisostere of Piperidine**[J]. Angewandte Chemie, 2023, 135 51. DOI:10.1002/ange.202311583
|
| | 6-Oxa-1-azaspiro[3.3]heptane oxalate(2:1) Preparation Products And Raw materials |
|