| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Potassium [4-(benzylamino-1-carbonyl)phenyl]trifluoroborate Basic information |
| Product Name: | Potassium [4-(benzylamino-1-carbonyl)phenyl]trifluoroborate | | Synonyms: | Potassium [4-(benzylamino-1-carbonyl)phenyl]trifluoroborate;potassium [4-(benzylcarbamoyl)phenyl]trifluoroboranuide;Potassium [4-(benzylamino-1-carbonyl)phenyl]trifluoroborate ISO 9001:2015 REACH;[4-(benzylcarbamoyl)phenyl]-trifluoroboranuide;Potassium (4-(benzylcarbamoyl)phenyl)trifluoroborate | | CAS: | 2017555-07-4 | | MF: | C14H12BF3KNO | | MW: | 317.16 | | EINECS: | 940-995-7 | | Product Categories: | | | Mol File: | 2017555-07-4.mol | ![Potassium [4-(benzylamino-1-carbonyl)phenyl]trifluoroborate Structure](CAS/20140525/GIF/CB42524643.gif) |
| | Potassium [4-(benzylamino-1-carbonyl)phenyl]trifluoroborate Chemical Properties |
| Melting point | 248-253 °C | | form | solid | | InChI | 1S/C14H12BF3NO.K/c16-15(17,18)13-8-6-12(7-9-13)14(20)19-10-11-4-2-1-3-5-11;/h1-9H,10H2,(H,19,20);/q-1;+1 | | InChIKey | RDEFKKXMPRJFFH-UHFFFAOYSA-N | | SMILES | [K+].F[B-](F)(F)c1ccc(cc1)C(=O)NCc2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Potassium [4-(benzylamino-1-carbonyl)phenyl]trifluoroborate Usage And Synthesis |
| | Potassium [4-(benzylamino-1-carbonyl)phenyl]trifluoroborate Preparation Products And Raw materials |
|