| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | 2-Deoxy-alpha-D-ribose 1-phosphate di(monocyclohexyl-ammonium) salt Basic information |
| | 2-Deoxy-alpha-D-ribose 1-phosphate di(monocyclohexyl-ammonium) salt Chemical Properties |
| storage temp. | −20°C | | solubility | H2O: 50 mg/mL, clear, faintly yellow | | form | powder | | color | white | | BRN | 3785872 | | InChI | 1S/2C6H13N.C5H11O7P/c2*7-6-4-2-1-3-5-6;6-2-4-3(7)1-5(11-4)12-13(8,9)10/h2*6H,1-5,7H2;3-7H,1-2H2,(H2,8,9,10)/t;;3-,4+,5+/m..0/s1 | | InChIKey | GVYUZZDUVZHJAM-CGKAESPRSA-N | | SMILES | NC1CCCCC1.NC2CCCCC2.OC[C@H]3O[C@@H](C[C@@H]3O)OP(O)(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids |
| | 2-Deoxy-alpha-D-ribose 1-phosphate di(monocyclohexyl-ammonium) salt Usage And Synthesis |
| Uses | 2-Deoxyribose 1-phosphate (2dR1P) may be used in pyrimidine metabolism research to identify and characterize thymidine phosphorylase(s)/platelet-derived endothelial cell growth factor(s)(PD-ECGF)/gliostatin(s). 2-Deoxyribose 1-phosphate may be used to study processes such as angiogenesis in tumor cells at the level of thymidine phosphorylase activity. 2-Deoxy-a-D-ribose 1-phosphate (dR-1-P) is used in the organic synthesis of 2′-deoxynucleosides such as cladribine. |
| | 2-Deoxy-alpha-D-ribose 1-phosphate di(monocyclohexyl-ammonium) salt Preparation Products And Raw materials |
|