|
|
| | 4-chloro-3-(pyridin-2-yl)aniline Basic information |
| Product Name: | 4-chloro-3-(pyridin-2-yl)aniline | | Synonyms: | 4-chloro-3-(pyridin-2-yl)aniline;4-chloro-3-(pyridin-2-yl)benzenaMine;4-Chloro-3-(2-pyridinyl)benzenamine;Vismodegib int-1 4-chloro-3-(pyridin-2-yl)benzenamine;4-chloro-3-(2-pyridinyl)aniline;4-CHLORO-3-(PYIDIN-2-YL)ANILINE;Benzenamine, 4-chloro-3-(2-pyridinyl)-;4-Chloro-3-(pyridine-2-yl)aniline | | CAS: | 879088-41-2 | | MF: | C11H9ClN2 | | MW: | 204.66 | | EINECS: | | | Product Categories: | | | Mol File: | 879088-41-2.mol |  |
| | 4-chloro-3-(pyridin-2-yl)aniline Chemical Properties |
| Melting point | 132 - 135°C | | Boiling point | 368.5±32.0 °C(Predicted) | | density | 1.261±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Dichloromethane (Slightly), Ethyl Acetate (Slightly) | | pka | 4.24±0.24(Predicted) | | form | Solid | | color | Pale Yellow to Light Yellow | | InChI | InChI=1S/C11H9ClN2/c12-10-5-4-8(13)7-9(10)11-3-1-2-6-14-11/h1-7H,13H2 | | InChIKey | QWVLHTCIAZPQAY-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(Cl)C(C2=NC=CC=C2)=C1 |
| | 4-chloro-3-(pyridin-2-yl)aniline Usage And Synthesis |
| Uses | 4-Chloro-3-(2-pyridinyl)benzenamine is a useful reagent for preparing smoothened (Smo) antagonists. Smo is an integral membrane protein involved with Hedgehog signaling. |
| | 4-chloro-3-(pyridin-2-yl)aniline Preparation Products And Raw materials |
|