- Vismodegib Impurity 8
-
- $0.00 / 10mg
-
2025-12-16
- CAS:879088-40-1
- Min. Order: 10mg
- Purity: 99%+ HPLC
- Supply Ability: 1000
|
| | 2-(2-chloro-5-nitrophenyl)pyridine Basic information |
| Product Name: | 2-(2-chloro-5-nitrophenyl)pyridine | | Synonyms: | 2-(2-chloro-5-nitrophenyl)pyridine;4-Chloro-3-(pyridin-2-yl)nitrobenzene;2-(2-chloro-5-nitrophenyl)pyridine hydrochloride;Pyridine, 2-(2-chloro-5-nitrophenyl)-;Vismodegib Impurity 10 | | CAS: | 879088-40-1 | | MF: | C11H7ClN2O2 | | MW: | 234.64 | | EINECS: | | | Product Categories: | | | Mol File: | 879088-40-1.mol |  |
| | 2-(2-chloro-5-nitrophenyl)pyridine Chemical Properties |
| Boiling point | 360.2±32.0 °C(Predicted) | | density | 1.366±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.10±0.24(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C11H7ClN2O2/c12-10-5-4-8(14(15)16)7-9(10)11-3-1-2-6-13-11/h1-7H | | InChIKey | AKVCBZWZBMTKMQ-UHFFFAOYSA-N | | SMILES | C1(C2=CC([N+]([O-])=O)=CC=C2Cl)=NC=CC=C1 |
| | 2-(2-chloro-5-nitrophenyl)pyridine Usage And Synthesis |
| Uses | 2-(2-Chloro-5-nitrophenyl)pyridine is used in the synthesis of Vismondegib (V674700) a hedgehog pathway inhibitor |
| | 2-(2-chloro-5-nitrophenyl)pyridine Preparation Products And Raw materials |
|