|
|
| | [1-hydroxy-2-(2-pyridinyl)ethylidene]bis(phosphonic acid) Basic information |
| Product Name: | [1-hydroxy-2-(2-pyridinyl)ethylidene]bis(phosphonic acid) | | Synonyms: | [1-hydroxy-2-(2-pyridinyl)ethylidene]bis(phosphonic acid);Risedronate EP Impurity B;Risedronate Related Compound A (20 mg) ([1-hydroxy-2-(2-pyridinyl)ethylidene]bis(phosphonic acid));NE 58018;P,P'-[1-Hydroxy-2-(2-pyridinyl)ethylidene]bisphosphonic acid;(1-hydroxy-1-phosphono-2-pyridin-2-ylethyl)phosphonic acid;Risedronate EP Impurity B (Risedronate USP Related Compound A);Risedronate Impurity 2(Risedronate EP Impurity B) | | CAS: | 105462-23-5 | | MF: | C7H11NO7P2 | | MW: | 283.11 | | EINECS: | | | Product Categories: | | | Mol File: | 105462-23-5.mol | ![[1-hydroxy-2-(2-pyridinyl)ethylidene]bis(phosphonic acid) Structure](CAS/GIF/105462-23-5.gif) |
| | [1-hydroxy-2-(2-pyridinyl)ethylidene]bis(phosphonic acid) Chemical Properties |
| storage temp. | 2-30°C | | solubility | Aqueous Base (Slightly), Methanol (Slightly) | | BRN | 8151626 | | Stability: | Hygroscopic | | Major Application | pharmaceutical small molecule | | InChI | 1S/C7H11NO7P2/c9-7(16(10,11)12,17(13,14)15)5-6-3-1-2-4-8-6/h1-4,9H,5H2,(H2,10,11,12)(H2,13,14,15) | | InChIKey | XXNASZAYANFLID-UHFFFAOYSA-N | | SMILES | [P](=O)(O)(O)C([P](=O)(O)O)(O)Cc1ncccc1 |
| Hazard Codes | Xi | | Risk Statements | 42/43 | | Safety Statements | 36/37 | | WGK Germany | WGK 3 | | HS Code | 2933399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| | [1-hydroxy-2-(2-pyridinyl)ethylidene]bis(phosphonic acid) Usage And Synthesis |
| Uses | 1-Hydroxy-2-(2-pyridinyl) Risedronate is an impurity in the synthesis of Risedronate (R521505), a pyridinyl biphosphonate bone resorption inhibitor. |
| | [1-hydroxy-2-(2-pyridinyl)ethylidene]bis(phosphonic acid) Preparation Products And Raw materials |
|