|
|
| | Risedronate Impurity C Basic information |
| Product Name: | Risedronate Impurity C | | Synonyms: | Risedronate EP Impurity C;ZWHKKFUMEGWCKH-UHFFFAOYSA-N;Risedronate Impurity C;Risedronate Impurity 3（Risedronate EP Impurity C）;P,P'-[1-Hydroxy-2-(4-pyridinyl)ethylidene]bis-phosphonic Acid;[1-Hydroxy-2-(pyridin-4-yl)ethylide;Phosphonic acid, P,P'-[1-hydroxy-2-(4-pyridinyl)ethylidene]bis-;Risedronate sodium 2.5-hydrate EP Impurity C | | CAS: | 105462-25-7 | | MF: | C7H11NO7P2 | | MW: | 283.11 | | EINECS: | | | Product Categories: | | | Mol File: | 105462-25-7.mol |  |
| | Risedronate Impurity C Chemical Properties |
| Melting point | >236°C (dec.) | | Boiling point | 694.7±65.0 °C(Predicted) | | density | 1.870±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Base (Slightly) | | pka | 1.41±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChI | 1S/C7H11NO7P2/c9-7(16(10,11)12,17(13,14)15)5-6-1-3-8-4-2-6/h1-4,9H,5H2,(H2,10,11,12)(H2,13,14,15) | | InChIKey | ZWHKKFUMEGWCKH-UHFFFAOYSA-N | | SMILES | [P](=O)([O-])(O)[C@]([P](=O)(O)O)(O)Cc1cc[n+H]cc1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | Risedronate Impurity C Usage And Synthesis |
| Uses | P,P''-[1-Hydroxy-2-(4-pyridinyl)ethylidene]bis-phosphonic Acid is used in biological studies for bisphosphonates preparation as it has Trypanosoma cruzi hexokinase inhibition properties. |
| | Risedronate Impurity C Preparation Products And Raw materials |
|