|
|
| | Torasemide Impurity 3 Basic information |
| Product Name: | Torasemide Impurity 3 | | Synonyms: | Torasemide Impurity 3;Torasemide Impurity 11;Torasemi Impurity 3;Torsemide Impurity;p-Torasemide (1-(1-Methylethyl)-3-[;Torsemide Impurity 3;3-Pyridinesulfonamide, N-[[(1-methylethyl)amino]carbonyl]-4-[(4-methylphenyl)amino]-;Torasemide Impurity 42 | | CAS: | 106944-63-2 | | MF: | C16H20N4O3S | | MW: | 348.42 | | EINECS: | | | Product Categories: | | | Mol File: | 106944-63-2.mol |  |
| | Torasemide Impurity 3 Chemical Properties |
| density | 1.283±0.06 g/cm3(Predicted) | | pka | 3.37±0.10(Predicted) | | InChI | InChI=1S/C16H20N4O3S/c1-11(2)18-16(21)20-24(22,23)15-10-17-9-8-14(15)19-13-6-4-12(3)5-7-13/h4-11H,1-3H3,(H,17,19)(H2,18,20,21) | | InChIKey | OYWIUXPFDBBNOK-UHFFFAOYSA-N | | SMILES | C1=NC=CC(NC2=CC=C(C)C=C2)=C1S(NC(NC(C)C)=O)(=O)=O |
| | Torasemide Impurity 3 Usage And Synthesis |
| | Torasemide Impurity 3 Preparation Products And Raw materials |
|