|
|
| | Deacetyl Iodixanol Basic information |
| Product Name: | Deacetyl Iodixanol | | Synonyms: | Deacetyl Iodixanol;5-[Acetyl[3-[[3,5-bis[(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]amino]-2-hydroxypropyl]amino]-N,N′-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide;Iodixanol impurity C;5-[[3-[N-acetyl-3,5-bis(2,3-dihydroxypropylcarbamoyl)-2,4,6-triiodoanilino]-2-hydroxypropyl]amino]-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide;Iodixanol EP impurity C;Iodixanol Impurity 3(Iodixanol EP Impurity C);5-[Acetyl[3-[[3,5-bis[[(2,3-dihydroxypropyl)aMino]carbonyl]-2,4,6-triiodophenyl]aMino]-2-hydroxypropyl]aMino]-N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-1,3-benzenedicarboxaMide;Desacetyl Iodixanol | | CAS: | 171897-74-8 | | MF: | C33H42I6N6O14 | | MW: | 1508.15 | | EINECS: | | | Product Categories: | Amines;Aromatics;Amines, Aromatics, Impurities, Labeling and Diagnostics Reagents;Impurities;Labeling and Diagnostics Reagents | | Mol File: | 171897-74-8.mol |  |
| | Deacetyl Iodixanol Chemical Properties |
| Boiling point | 1197.2±65.0 °C(Predicted) | | density | 2.344±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.34±0.46(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChIKey | RREZWVKPVJDLJN-UHFFFAOYSA-N | | SMILES | C1(C(NCC(O)CO)=O)=C(I)C(N(C(C)=O)CC(O)CNC2=C(I)C(C(NCC(O)CO)=O)=C(I)C(C(NCC(O)CO)=O)=C2I)=C(I)C(C(NCC(O)CO)=O)=C1I |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Deacetyl Iodixanol Usage And Synthesis |
| Uses | An impurity in the preparation of the x-ray contrast agent Iodixanol. |
| | Deacetyl Iodixanol Preparation Products And Raw materials |
|