| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Des(2,3-dihydroxypropyl) Iodixanol Basic information |
| Product Name: | Des(2,3-dihydroxypropyl) Iodixanol | | Synonyms: | Iodixanol Related Compound E (25 mg)(5-[[3-[[3-[[(2,3-Dihydoxypropyl)amino]carbonyl]-5-[[amino]carbonyl]-2,4,6-triiodophenyl](acetylimino)]-2-hydroxypropyl]-(acetylimino)]-N,N'-bis(2,3-dihydoxypropyl)-2,4,6-triiodo-1,3-benzenedicarboxamide);Des(2,3-dihydroxypropyl) Iodixanol;Iodixanol Related Compou;5-[Acetyl[3-[acetyl[3-carbamoyl-5-[(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]amino]-2-hydroxypropyl]amino]-N,N′-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide;Iodixanol amide;Iodixanol impurity E;Iodixanol Related Compound E (25 mg) (5-{N-[3-(N-{3-carbamoyl-5-[(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl}acetamido)-2-hydroxypropyl]acetamido}-N1,N3-bis(2,3-dihydroxypropyl)-2,4,6-triiodoisophthalamide);Iodixanol EP impurity E | | CAS: | 255376-57-9 | | MF: | C32H38I6N6O13 | | MW: | 1476.1 | | EINECS: | | | Product Categories: | Amines;Aromatics;Impurities;Labeling and Diagnostics Reagents;Aromatics, Impurities, Labeling and Diagnostics Reagents | | Mol File: | 255376-57-9.mol |  |
| | Des(2,3-dihydroxypropyl) Iodixanol Chemical Properties |
| Boiling point | 1160.4±65.0 °C(Predicted) | | density | 2.360±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.34±0.46(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChIKey | ODLMOUNYBXWCKZ-UHFFFAOYSA-N | | SMILES | C1(C(NCC(O)CO)=O)=C(I)C(N(C(C)=O)CC(O)CN(C(C)=O)C2=C(I)C(C(NCC(O)CO)=O)=C(I)C(C(N)=O)=C2I)=C(I)C(C(NCC(O)CO)=O)=C1I |
| WGK Germany | WGK 3 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids |
| | Des(2,3-dihydroxypropyl) Iodixanol Usage And Synthesis |
| Uses | A related compound of the x-ray contrast agent Iodixanol. |
| | Des(2,3-dihydroxypropyl) Iodixanol Preparation Products And Raw materials |
|