| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
(S)-2-[N'-(N-Benzylprolyl)amino]benzophenone manufacturers
|
| | (S)-2-[N'-(N-Benzylprolyl)amino]benzophenone Basic information |
| Product Name: | (S)-2-[N'-(N-Benzylprolyl)amino]benzophenone | | Synonyms: | 2-Pyrrolidinecarboxamide, N-(2-benzoylphenyl)-1-(phenylmethyl)-, (2S)-;(S)-2-N'-(N-BENZYLPROLYL)AMINOaBENZO- PHENONE, 99.5+%;(S)-2-N'-(N-Benzylprolyl)aminoenzophenone;(S)-2-[N'-(N-Benzylprolyl)amino]benzophenone,99.5+%;(S)-2-[N'-(N-Benzylprolyl)amino]benzophenoneBPB;(2S)-2-Pyrrolidinecarboxamide, N-(2-benzoylphenyl)-1-(phenylmethyl)-;(S)-N-(2-Benzoylphenyl)-1-benzylpyrrolidine-2-carboxamide;N-(2-benzoylphenyl)-1-(phenylmethyl)-(2S)-2-Pyrrolidinecarboxamide | | CAS: | 96293-17-3 | | MF: | C25H24N2O2 | | MW: | 384.47 | | EINECS: | | | Product Categories: | | | Mol File: | 96293-17-3.mol | ![(S)-2-[N'-(N-Benzylprolyl)amino]benzophenone Structure](CAS/GIF/96293-17-3.gif) |
| | (S)-2-[N'-(N-Benzylprolyl)amino]benzophenone Chemical Properties |
| Melting point | 100-103 °C | | Boiling point | 511.14°C (rough estimate) | | density | 1.1573 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Store below +30°C. | | solubility | sol CHCl3; insol MeOH | | pka | 13.68±0.70(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | λmax | 240nm(MeOH)(lit.) | | InChI | InChI=1S/C25H24N2O2/c28-24(20-12-5-2-6-13-20)21-14-7-8-15-22(21)26-25(29)23-16-9-17-27(23)18-19-10-3-1-4-11-19/h1-8,10-15,23H,9,16-18H2,(H,26,29)/t23-/m0/s1 | | InChIKey | IPSABLMEYFYEHS-QHCPKHFHSA-N | | SMILES | N1(CC2=CC=CC=C2)CCC[C@H]1C(NC1=CC=CC=C1C(=O)C1=CC=CC=C1)=O |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 highly water endangering | | HS Code | 2933 99 80 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | (S)-2-[N'-(N-Benzylprolyl)amino]benzophenone Usage And Synthesis |
| Chemical Properties | LIGHT YELLOW CRYSTALLINE POWDER | | Preparation | (S)-2-[N'-(N-BENZYLPROLYL)AMINO]BENZOPHENONE can be prepared by condensation of (S)-o-[(N-benzylprolyl)amino]benzophenone (BBP) with glycine in the presence of nickel(II) nitrate in methanol. | | Purification Methods | (S)-2-[N'-(N-BENZYLPROLYL)AMINO]BENZOPHENONE can be purified by sequential chromatography over silica gel and Sephadex LH-20, or by dry flash chromatography. | | Precautions | care should be taken in applying (S)-2-[N'-(N-BENZYLPROLYL)AMINO]BENZOPHENONE to purified Sephadex. The addition of basic media can present an explosion hazard. |
| | (S)-2-[N'-(N-Benzylprolyl)amino]benzophenone Preparation Products And Raw materials |
|