| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Yttrium trifluoroacetate Basic information |
| | Yttrium trifluoroacetate Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Crystalline | | Water Solubility | Insoluble in water. | | InChI | 1S/3C2HF3O2.Y/c3*3-2(4,5)1(6)7;/h3*(H,6,7);/q;;;+3/p-3 | | InChIKey | NPATVYPXYMSPKD-UHFFFAOYSA-K | | SMILES | FC(F)(F)C(=O)O[Y](OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Yttrium trifluoroacetate Usage And Synthesis |
| Uses | A fluorinated yttrium compound for proteomics research. Used in the manufacture of ceramics, glass, laser materials, phosphor. non-ferrous alloy iron and steel, and the additives. | | reaction suitability | reagent type: catalyst core: yttrium |
| | Yttrium trifluoroacetate Preparation Products And Raw materials |
|