| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 5-BroMo-2-(tert-butyldiMethylsilyl)thiazole Basic information |
| | 5-BroMo-2-(tert-butyldiMethylsilyl)thiazole Chemical Properties |
| Boiling point | 269.3±32.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | form | solid | | pka | 1.47±0.10(Predicted) | | InChI | 1S/C9H16BrNSSi/c1-9(2,3)13(4,5)8-11-6-7(10)12-8/h6H,1-5H3 | | InChIKey | BGLPSYCSWHSYBG-UHFFFAOYSA-N | | SMILES | BrC1=CN=C([Si](C)(C)C(C)(C)C)S1 |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 5-BroMo-2-(tert-butyldiMethylsilyl)thiazole Usage And Synthesis |
| | 5-BroMo-2-(tert-butyldiMethylsilyl)thiazole Preparation Products And Raw materials |
|