| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 2-(tert-ButyldiMethylsilyl)-4-Methylthiazole Basic information |
| Product Name: | 2-(tert-ButyldiMethylsilyl)-4-Methylthiazole | | Synonyms: | 2-(tert-ButyldiMethylsilyl)-4-Methylthiazole;Thiazole, 2-[(1,1-dimethylethyl)dimethylsilyl]-4-methyl-;2-[(1,1-Dimethylethyl)dimethylsilyl]-4-methylthiazole;2-(tert-Butyldimethylsilyl)-4-methylthiazole;2-(tert-Butyldimethylsilyl)-4-methyl-1,3-thiazole | | CAS: | 1245782-58-4 | | MF: | C10H19NSSi | | MW: | 213.42 | | EINECS: | | | Product Categories: | | | Mol File: | 1245782-58-4.mol |  |
| | 2-(tert-ButyldiMethylsilyl)-4-Methylthiazole Chemical Properties |
| form | solid | | InChI | 1S/C10H19NSSi/c1-8-7-12-9(11-8)13(5,6)10(2,3)4/h7H,1-6H3 | | InChIKey | OHCKALFODDMEQM-UHFFFAOYSA-N | | SMILES | C[Si](C1=NC(C)=CS1)(C(C)(C)C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(tert-ButyldiMethylsilyl)-4-Methylthiazole Usage And Synthesis |
| | 2-(tert-ButyldiMethylsilyl)-4-Methylthiazole Preparation Products And Raw materials |
|