|
|
| | 2-BROMO-4-ISOPROPYLANILINE Basic information |
| | 2-BROMO-4-ISOPROPYLANILINE Chemical Properties |
| Boiling point | 116 °C | | density | 1.35 | | refractive index | 1.5750 to 1.5790 | | Fp | 116-118°C/3mm | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.94±0.10(Predicted) | | form | clear liquid | | color | Colorless to Yellow | | Specific Gravity | 1.35 | | Water Solubility | Miscible with dioxane and ethoxyethanol. Immiscible with water. | | BRN | 2638470 | | InChI | InChI=1S/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 | | InChIKey | WEMDUNBELVTSRP-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C(C)C)C=C1Br | | CAS DataBase Reference | 51605-97-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | RIDADR | UN2810 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2921420090 |
| Provider | Language |
|
ALFA
| English |
| | 2-BROMO-4-ISOPROPYLANILINE Usage And Synthesis |
| Uses | 2-Bromo-4-isopropylaniline is involved in the preparation of 4-(5-aryl-1, 2, 3, 6-tetrahydropyridino) pyrimidine derivatives and 4-substituted-2-anilinopyrimidine derivatives, which find application as corticotropin releasing factor (CRF) antagonists. |
| | 2-BROMO-4-ISOPROPYLANILINE Preparation Products And Raw materials |
|