- Valdecoxib IMpurity D
-
- $1.00
-
2019-07-06
- CAS: 181696-35-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000KG
|
| | Valdecoxib IMpurity D Basic information |
| Product Name: | Valdecoxib IMpurity D | | Synonyms: | 4-(5-Methyl-3-phenyl-4-isoxazolyl)benzenesulfonic Acid;Valdecoxib IMpurity D;Valdecoxib Sulfonic Acid;2,6-DICHLORO-4-(TRIFLUOROMETHYLOXY)BROMOBENZENE;4-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonic acid;Valdecoxib IMpurity-D (Valdecoxib SulfonicAcid);Benzenesulfonic acid, 4-(5-Methyl-3-phenyl-4-isoxazolyl)-;3-Phenyl-4-(4-aMinosulfonylbenzyl)-5-Methylisoxazole ,Valdecoxib Sulfonyl Chloride ,valdecoxib iMpurity D | | CAS: | 181696-35-5 | | MF: | C16H13NO4S | | MW: | 315.34 | | EINECS: | | | Product Categories: | | | Mol File: | 181696-35-5.mol |  |
| | Valdecoxib IMpurity D Chemical Properties |
| Melting point | >88°C (dec.) | | density | 1.341±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetone (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | -0.92±0.50(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C16H13NO4S/c1-11-15(12-7-9-14(10-8-12)22(18,19)20)16(17-21-11)13-5-3-2-4-6-13/h2-10H,1H3,(H,18,19,20) | | InChIKey | LLWOSCPRJRUVST-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC=C(C2=C(C)ON=C2C2=CC=CC=C2)C=C1 |
| | Valdecoxib IMpurity D Usage And Synthesis |
| Uses | Valdecoxib Sulfonic Acid is a metabolite of the potent and specific inhibitor of cyclooxygenase-2, Valdecoxib (V090000). |
| | Valdecoxib IMpurity D Preparation Products And Raw materials |
|