|
|
| | Valdecoxib IMpurity B Basic information |
| | Valdecoxib IMpurity B Chemical Properties |
| Melting point | >271°C (dec.) | | Boiling point | 732.7±70.0 °C(Predicted) | | density | 1.343±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | -4.23±0.40(Predicted) | | form | Solid | | color | White to Off-White | | InChIKey | FDUYPVXQEAKTGG-UHFFFAOYSA-N | | SMILES | C1(S(NS(C2=CC=C(C3=C(C)ON=C3C3=CC=CC=C3)C=C2)(=O)=O)(=O)=O)=CC=C(C2=C(C)ON=C2C2=CC=CC=C2)C=C1 |
| | Valdecoxib IMpurity B Usage And Synthesis |
| Uses | Valdecoxib Dimer is a dimeric impurity of the cyclooxygenase-2 inhibitor, Valdecoxib (V090000). |
| | Valdecoxib IMpurity B Preparation Products And Raw materials |
|