|
|
| | NE 10790 Basic information |
| Product Name: | NE 10790 | | Synonyms: | 3-PEHPC;NE 10790;FJVYPXVLXQXDHM-UHFFFAOYSA-N;NE 10790 (Synonyms: 3-PEHPC);NE 10790 (3-PEHPC);2-hydroxy-2-phosphono-3-(pyridin-3-yl)propanoic acid;3-Pyridinepropanoic acid, α-hydroxy-α-phosphono-;NE10790,NE-10790,inhibit,NE 10790,Inhibitor | | CAS: | 152831-36-2 | | MF: | C8H10NO6P | | MW: | 247.14 | | EINECS: | | | Product Categories: | API | | Mol File: | 152831-36-2.mol |  |
| | NE 10790 Chemical Properties |
| Boiling point | 583.6±60.0 °C(Predicted) | | density | 1.724±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | Water:5.0(Max Conc. mg/mL);20.2(Max Conc. mM) | | pka | 1.73±0.10(Predicted) | | form | Solid | | color | White to off-white | | Water Solubility | H2O: 2mg/mL, clear (Warmed) | | InChIKey | FJVYPXVLXQXDHM-UHFFFAOYSA-N | | SMILES | [P](=O)(O)(O)C(O)(Cc1cnccc1)C(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | NE 10790 Usage And Synthesis |
| Uses | 3-PEHPC is a phosphonocarboxylate inhibitor of Rab geranylgeranyl transferase and is used in antiosteoporotic drugs. | | Biological Activity | 3-PEHPC (NE 10790), a phosphonocarboxylate analogue of the bisphosphonate risedronate, is a potent and selective inhibitor of geranylgeranyl transferase II (GGTase II). |
| | NE 10790 Preparation Products And Raw materials |
|