| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | Rafoxanide-13C6 Basic information |
| Product Name: | Rafoxanide-13C6 | | Synonyms: | N-[3-Chloro-4-(4-chlorophenoxy)phenyl]-2-hydroxy-3,5-diiodobenz-13C6-amide;Rafoxanide-(benzoyl ring-13C6);Rafoxanide-13C6;[13C6]-Rafoxanide;Risperidone Impurity 26;Rafoxanide-(benzoyl ring-13C6);Rafoxanide 13C6 (benzoyl ring 13C6) 100 μg/mL in Acetonitrile | | CAS: | 1353867-98-7 | | MF: | C19H11Cl2I2NO3 | | MW: | 631.97 | | EINECS: | | | Product Categories: | | | Mol File: | 1353867-98-7.mol |  |
| | Rafoxanide-13C6 Chemical Properties |
| density | 2.050±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChI | 1S/C19H11Cl2I2NO3/c20-10-1-4-13(5-2-10)27-17-6-3-12(9-15(17)21)24-19(26)14-7-11(22)8-16(23)18(14)25/h1-9,25H,(H,24,26)/i7+1,8+1,11+1,14+1,16+1,18+1 | | InChIKey | NEMNPWINWMHUMR-QBPDDYRQSA-N | | SMILES | O[13c]1[13c](I)[13cH][13c](I)[13cH][13c]1C(=O)Nc2ccc(Oc3ccc(Cl)cc3)c(Cl)c2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Rafoxanide-13C6 Usage And Synthesis |
| Uses | Rafoxanide-13C6 is the labeled form of Rafoxanide (R073500), which is a thyroid hormone receptor. |
| | Rafoxanide-13C6 Preparation Products And Raw materials |
|