| Company Name: |
2D Pharma Gold |
| Tel: |
18920851381 18920851381 |
| Email: |
1626636005@qq.com |
25-HydroxyprovitaMin D3 manufacturers
|
| | 25-HydroxyprovitaMin D3 Basic information |
| Product Name: | 25-HydroxyprovitaMin D3 | | Synonyms: | 25-HydroxyprovitaMin D3;IMpurity B of Calcifediol;(3S,9S,10R,13R,14R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol;Calcifediol EP Impurity B/Cholesta-5,7-diene-3β,25-dio;Calcifediol Impurity 2（Calcifediol EP Impurity B）;cholesta-5,7-diene-3β,25-diol;Cholesta-5,7-diene-3,25-diol, (3β)-;Cholesta-5,7-diene-3B,25-diol, | | CAS: | 22145-68-2 | | MF: | C27H44O2 | | MW: | 400.65 | | EINECS: | | | Product Categories: | | | Mol File: | 22145-68-2.mol |  |
| | 25-HydroxyprovitaMin D3 Chemical Properties |
| Melting point | 169-171 °C | | Boiling point | 527.0±43.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | pka | 14.91±0.70(Predicted) | | InChIKey | JJFYNCJHSCTBPW-JDBQHWKHNA-N | | SMILES | C[C@]12CC[C@]3([H])[C@]4(CC[C@H](O)CC4=CC=C3[C@]1([H])CC[C@]2([H])[C@H](C)CCCC(O)(C)C)C |&1:1,4,6,9,16,20,22,r| |
| | 25-HydroxyprovitaMin D3 Usage And Synthesis |
| Uses | 25-Hydroxyprovitamin D3 (Chloesterol Impurity 6) is an impurity of Calcifediol (C125700) which is a metabolite of Vitamin D. | | Definition | ChEBI: Cholesta-5,7-dien-3beta,25-diol is a cholestanoid that is 7-dehydrocholesterol carrying an additional hydroxy substituent at position 25. It has a role as a human metabolite and a Saccharomyces cerevisiae metabolite. It is a 25-hydroxy steroid, a cholestanoid, a 3beta-hydroxy-Delta(5)-steroid and a C27-steroid. It is functionally related to a cholesta-5,7-dien-3beta-ol. | | General Description | 25-HydroxyprovitaMin D3 (25-OH-7-DHC) is a by-product produced during the synthesis of calcidiol. Calcifediol is a drug used to treat vitamin D deficiency. |
| | 25-HydroxyprovitaMin D3 Preparation Products And Raw materials |
|