|
|
| | 2,4-DibroMo-5-Methylthiazole Basic information |
| | 2,4-DibroMo-5-Methylthiazole Chemical Properties |
| Boiling point | 260.7±20.0 °C(Predicted) | | density | 2.127±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -1.45±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C4H3Br2NS/c1-2-3(5)7-4(6)8-2/h1H3 | | InChIKey | HJUNCDFVUMUFOW-UHFFFAOYSA-N | | SMILES | S1C(C)=C(Br)N=C1Br |
| | 2,4-DibroMo-5-Methylthiazole Usage And Synthesis |
| References | [1] Synthesis (Germany), 2014, vol. 46, # 11, p. 1469 - 1474 [2] Patent: WO2015/197187, 2015, A1. Location in patent: Page/Page column 28 [3] Journal of Materials Chemistry, 2011, vol. 21, # 43, p. 17249 - 17258 [4] Patent: US2016/145249, 2016, A1 |
| | 2,4-DibroMo-5-Methylthiazole Preparation Products And Raw materials |
|