| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Oxybutynin IMpurity C Basic information |
| Product Name: | Oxybutynin IMpurity C | | Synonyms: | Oxybutynin IMpurity C;Oxybutynin hydrochloride EP impurity C;4-(Ethylmethylamino)but-2-ynyl (±)-2-cyclohexyl-2-hydroxy-2-phenylacetate hydrochloride;4-[ethyl(methyl)amino]but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;Oxybutynin EP Impurity C;Benzeneacetic acid, α-cyclohexyl-α-hydroxy-, 4-(ethylmethylamino)-2-butyn-1-yl ester;Oxybutynin Impurity 9;Oxybutynin Impurity 28 | | CAS: | 1199574-70-3 | | MF: | C21H29NO3 | | MW: | 343.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1199574-70-3.mol |  |
| | Oxybutynin IMpurity C Chemical Properties |
| Major Application | pharmaceutical (small molecule) | | InChI | 1S/C21H29NO3/c1-3-22(2)16-10-11-17-25-20(23)21(24,18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4,6-7,12-13,19,24H,3,5,8-9,14-17H2,1-2H3 | | InChIKey | FWVUDIODXYRQJW-UHFFFAOYSA-N | | SMILES | N(CC)(CC#CCOC(=O)C(O)(C2CCCCC2)c1ccccc1)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Oxybutynin IMpurity C Usage And Synthesis |
| Uses | N-Methyl Oxybutynin is an impurity of oxybutynin; a medication for the treatment of overactive bladder and other incontinence. |
| | Oxybutynin IMpurity C Preparation Products And Raw materials |
|