TranylcyproMine (2-PCPA) HCl manufacturers
|
| | TranylcyproMine (2-PCPA) HCl Basic information |
| Product Name: | TranylcyproMine (2-PCPA) HCl | | Synonyms: | TranylcyproMine (2-PCPA) HCl;(1S,2R)-2-Phenyl-cyclopropylamine hydrochloride;(1S,2R)-2-Phenylcyclopropan-1-amine hydrochloride;(1S,2R)-2-Phenylcyclopropanamine hydrochloride;(+)-Tranylcypromine HCl;Tranylcypromine Hydrochloride (1.0 mg/mL in Methanol);(1S,2R)-Tranylcypromine (hydrochloride);(+)-Tranylcypromine HydrochlorideQ: What is
(+)-Tranylcypromine Hydrochloride Q: What is the CAS Number of
(+)-Tranylcypromine Hydrochloride Q: What is the storage condition of
(+)-Tranylcypromine Hydrochloride Q: What are the applications of
(+)-Tranylcypromine Hydrochloride | | CAS: | 4548-34-9 | | MF: | C9H11N.ClH | | MW: | 169.65 | | EINECS: | | | Product Categories: | | | Mol File: | 4548-34-9.mol |  |
| | TranylcyproMine (2-PCPA) HCl Chemical Properties |
| storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | InChI | InChI=1/C9H11N.ClH/c10-9-6-8(9)7-4-2-1-3-5-7;/h1-5,8-9H,6,10H2;1H/t8-,9+;/s3 | | InChIKey | ZPEFMSTTZXJOTM-HLRUTPIHNA-N | | SMILES | N[C@H]1C[C@@H]1C1C=CC=CC=1.Cl |&1:1,3,r| |
| | TranylcyproMine (2-PCPA) HCl Usage And Synthesis |
| Uses | Tranylcypromine is a monoamine oxidase inhibitor, which inhibits CYP2A6 with Ki of 0.08 μM and 0.2 μM in cDNA-expressing microsomes and Human Liver Microsomes, respectively. | | Definition | ChEBI: (1S,2R)-tranylcypromine hydrochloride is a hydrochloride obtained by combining (1S,2R)-tranylcypromine with one equivalent of hydrochloric acid. It contains a (1S,2R)-tranylcypromine(1+). It is an enantiomer of a (1R,2S)-tranylcypromine hydrochloride. | | IC 50 | KDM1/LSD1 |
| | TranylcyproMine (2-PCPA) HCl Preparation Products And Raw materials |
|