|
|
| | 5-Methyl-2-phenylbenzoic acid Basic information |
| | 5-Methyl-2-phenylbenzoic acid Chemical Properties |
| Melting point | 155 °C(Solv: acetonitrile (75-05-8)) | | Boiling point | 351.9±11.0 °C(Predicted) | | density | 1.156±0.06 g/cm3(Predicted) | | pka | 3.53±0.10(Predicted) | | form | solid | | InChI | 1S/C14H12O2/c1-10-7-8-12(13(9-10)14(15)16)11-5-3-2-4-6-11/h2-9H,1H3,(H,15,16) | | InChIKey | UUBWFNDPWDNPTE-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC(C)=CC=C1C2=CC=CC=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 5-Methyl-2-phenylbenzoic acid Usage And Synthesis |
| | 5-Methyl-2-phenylbenzoic acid Preparation Products And Raw materials |
|