|
|
| | 3,4-Dinitro-benzaldehyde Basic information |
| | 3,4-Dinitro-benzaldehyde Chemical Properties |
| Melting point | 62.5 °C(Solv: ligroine (8032-32-4); benzene (71-43-2)) | | Boiling point | 401.2±35.0 °C(Predicted) | | density | 1.571±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C7H4N2O5/c10-4-5-1-2-6(8(11)12)7(3-5)9(13)14/h1-4H | | InChIKey | HWEAXMDJIUCDRB-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C([N+]([O-])=O)C([N+]([O-])=O)=C1 |
| | 3,4-Dinitro-benzaldehyde Usage And Synthesis |
| Uses | 3,4-Dinitrobenzaldehyde (cas# 35998-98-2) is a useful research chemical. It’s used in the preparation of unsaturated carboxamides for treatment of neuroinflammatory diseases. |
| | 3,4-Dinitro-benzaldehyde Preparation Products And Raw materials |
|