| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,2-Dimethyl-1H-pyrrole-3-carboxylic acid Basic information |
| | 1,2-Dimethyl-1H-pyrrole-3-carboxylic acid Chemical Properties |
| Boiling point | 287.2±20.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 5.70±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H9NO2/c1-5-6(7(9)10)3-4-8(5)2/h3-4H,1-2H3,(H,9,10) | | InChIKey | ZQJODLRWWIIHDM-UHFFFAOYSA-N | | SMILES | N1(C)C=CC(C(O)=O)=C1C |
| | 1,2-Dimethyl-1H-pyrrole-3-carboxylic acid Usage And Synthesis |
| | 1,2-Dimethyl-1H-pyrrole-3-carboxylic acid Preparation Products And Raw materials |
|