|
|
| | 2-Methyl-1H-pyrrole-3-carboxylic acid ethyl ester Basic information |
| Product Name: | 2-Methyl-1H-pyrrole-3-carboxylic acid ethyl ester | | Synonyms: | Ethyl 2-methylpyrrole-3-carboxylate;ETHYL 2-METHYL-3-PYRROLECARBOXYLATE;1H-Pyrrole-3-carboxylicacid, 2-Methyl-, ethyl ester;Pyrrole-3-carboxylic acid, 2-methyl-, ethyl ester;2-Methyl-1H-pyrrole-3-carboxylic acid ethyl ester≥ 97.5% (HPLC);2-Methyl-1H-Pyrrole-3-Carboxylic Acid Ethyl Ester(WX618048);TIANFU CHEM----2-METHYL-1H-PYRROLE-3-CARBOXYLIC ACID ETHYL ESTER;2-methylpyridine-3-ethyl formate | | CAS: | 936-12-9 | | MF: | C8H11NO2 | | MW: | 153.18 | | EINECS: | | | Product Categories: | Pyrrole&Pyrrolidine&Pyrroline | | Mol File: | 936-12-9.mol |  |
| | 2-Methyl-1H-pyrrole-3-carboxylic acid ethyl ester Chemical Properties |
| Melting point | 78-79 °C(Solv: ethanol (64-17-5)) | | Boiling point | 289.7±20.0 °C(Predicted) | | density | 1.106 | | storage temp. | 2-8°C | | pka | 16.14±0.50(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C8H11NO2/c1-3-11-8(10)7-4-5-9-6(7)2/h4-5,9H,3H2,1-2H3 | | InChIKey | DJDPDVJJTIGJTE-UHFFFAOYSA-N | | SMILES | N1C=CC(C(OCC)=O)=C1C |
| | 2-Methyl-1H-pyrrole-3-carboxylic acid ethyl ester Usage And Synthesis |
| Chemical Properties | White to orange-red crystalline powder |
| | 2-Methyl-1H-pyrrole-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|