| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | tert-Butyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate Basic information |
| Product Name: | tert-Butyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate | | Synonyms: | tert-Butyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate - B6708;tert-Butyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate;6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-ol;1-Oxa-6-azaspiro[3.3]heptane-6-carboxylic acid, 3-hydroxy-, 1,1-dimethylethyl ester;6-Boc-3-hydroxy-1-oxa-6-azaspiro[3.3]heptane;tert-Butyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate;1,1-Dimethylethyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate | | CAS: | 1349199-63-8 | | MF: | C10H17NO4 | | MW: | 215.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1349199-63-8.mol | ![tert-Butyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate Structure](CAS/GIF/1349199-63-8.gif) |
| | tert-Butyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate Chemical Properties |
| Boiling point | 344.8±42.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | liquid | | pka | 14.00±0.20(Predicted) | | InChI | 1S/C10H17NO4/c1-9(2,3)15-8(13)11-5-10(6-11)7(12)4-14-10/h7,12H,4-6H2,1-3H3 | | InChIKey | BFXOBAHLWARETK-UHFFFAOYSA-N | | SMILES | OC1C2(CN(C(OC(C)(C)C)=O)C2)OC1 |
| RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | tert-Butyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate Usage And Synthesis |
| Uses | Spirocyclic building block is part of a series of advanced angular[3.3]heptanes developed by Carreira and coworkers |
| | tert-Butyl 3-hydroxy-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate Preparation Products And Raw materials |
|