Isosilybin A manufacturers
- Isosilybin A
-
- $80.00
-
2026-09-10
- CAS:142796-21-2
- Purity: 99.88%
- Supply Ability: 10g
- Isosilybin A
-
-
2024-04-12
- CAS:142796-21-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000ton
|
| | Isosilybin A Basic information |
| Product Name: | Isosilybin A | | Synonyms: | Isosilybin A;(2R,3R)-3,5,7-Trihydroxy-2-[(2R,3R)-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydrobenzo[1,4]dioxin-6-yl]-4-chromanone;(2R,3R)-2-[(2R,3R)-2,3-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one;Isosilibinin A;Silybin b2;4H-1-Benzopyran-4-one, 2-[(2R,3R)-2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)-;Isosilybin A，ISB-A;Isosilybin A/(+)-Isosilybin A,Silybin b2 | | CAS: | 142796-21-2 | | MF: | C25H22O10 | | MW: | 482.44 | | EINECS: | | | Product Categories: | | | Mol File: | 142796-21-2.mol |  |
| | Isosilybin A Chemical Properties |
| Melting point | 158-160 °C(Solv: methanol (67-56-1)) | | Boiling point | 793.0±60.0 °C(Predicted) | | density | 1.527±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO | | form | Solid | | pka | 7.39±0.60(Predicted) | | color | White to off-white | | InChIKey | FDQAOULAVFHKBX-HKTJVKLFSA-N | | SMILES | [C@H]1(C2=CC=C3O[C@H](C4=CC=C(O)C(OC)=C4)[C@@H](CO)OC3=C2)OC2=CC(O)=CC(O)=C2C(=O)[C@@H]1O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Isosilybin A Usage And Synthesis |
| Uses | Isosilybin A is one of the flavonolignans extracted from the seeds of milk thistle. Isosilybin A and isosilybin B (I109003) were also the most effective suppressors of prostate-specific antigen secretion by androgen-dependent LNCaP cells. |
| | Isosilybin A Preparation Products And Raw materials |
|