- R 5011 (dopant)
-
- $50.00
-
2026-08-06
- CAS:944537-61-5
- Min. Order: 1KG
- Purity: 99%
- R 5011 (dopant)
-
- $1.10
-
2026-06-16
- CAS:944537-61-5
- Min. Order: 1g
- Purity: 99.9%
- Supply Ability: 100 Tons Min
|
| | R 5011 (dopant) Basic information |
| Product Name: | R 5011 (dopant) | | Synonyms: | R 5011;R 5011 (dopant);Chiral Dopant R5011;R5011 Right;4H-Dinaphtho[2,1-f:1',2'-h][1,5]dioxonin, 5,6-dihydro-5-(trans-4-propylcyclohexyl)-, (13bR)-;(11BR)-9-(4-propylcyclohexyl)-9,10-dihydro-8H-dinaphtho[2,1-f:1',2'-h][1,5]dioxonine;(6AR,17cS)-5-(4-propylcyclohexyl)-4,4a,5,6,6a,17c-hexahydro-8H-dinaphtho[2,1-f:1',2'-h][1,5]dioxonine;(13bR)-5,6-Dihydro-5-(trans-4-propylcyclohexyl)-4H-dinaphtho[2,1-f:1',2'-h][1,5]dioxocine | | CAS: | 944537-61-5 | | MF: | C32H34O2 | | MW: | 450.61 | | EINECS: | | | Product Categories: | | | Mol File: | 944537-61-5.mol |  |
| | R 5011 (dopant) Chemical Properties |
| Boiling point | 633.1±25.0 °C(Predicted) | | density | 1.115±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChIKey | SWMVTIVDYXJOCY-MPUCSWFWSA-N | | SMILES | O1C2=CC=C3C(=C2C2=C4C(=CC=CC4)C=CC2OCC=C1)C(C1CCC(CCC)CC1)CC=C3 |c:22| |
| | R 5011 (dopant) Usage And Synthesis |
| Uses | Chiral dopants, also called a doping agent, is a trace impurity element that is inserted into a substance (in very low concentrations) to alter the electrical or optical properties of the substance. In the case of crystalline substances, the atoms of the dopant very commonly take the place of elements that were in the crystal lattice of the base material. |
| | R 5011 (dopant) Preparation Products And Raw materials |
|