6-Chloro-2-Methyl-2H-pyridazin-3-one manufacturers
|
| | 6-Chloro-2-Methyl-2H-pyridazin-3-one Basic information |
| Product Name: | 6-Chloro-2-Methyl-2H-pyridazin-3-one | | Synonyms: | 6-Chloro-2-Methyl-2H-pyridazin-3-one;3(2H)-Pyridazinone, 6-chloro-2-methyl-;6-chloro-2-methylpyridazin-3-one;6-chloro-2-methyl-2,3-dihydropyridazin-3-one - [C81076];6-chloro-2-methylpyridazin-3(2H)-one | | CAS: | 10071-38-2 | | MF: | C5H5ClN2O | | MW: | 144.56 | | EINECS: | | | Product Categories: | | | Mol File: | 10071-38-2.mol |  |
| | 6-Chloro-2-Methyl-2H-pyridazin-3-one Chemical Properties |
| Melting point | 92-94 °C | | Boiling point | 210.7±23.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -1.47±0.70(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C5H5ClN2O/c1-8-5(9)3-2-4(6)7-8/h2-3H,1H3 | | InChIKey | IMBNTYIRTCQBRJ-UHFFFAOYSA-N | | SMILES | C1(=O)N(C)N=C(Cl)C=C1 |
| | 6-Chloro-2-Methyl-2H-pyridazin-3-one Usage And Synthesis |
| Uses | 6-Chloro-2-methylpyridazin-3(2H)-one is used in the preparation of histamine H3 receptor agonists for the treatment of sleeping disorders. |
| | 6-Chloro-2-Methyl-2H-pyridazin-3-one Preparation Products And Raw materials |
|