|
|
| | 1-Methyl-1H-pyrazol-3-amine Basic information |
| | 1-Methyl-1H-pyrazol-3-amine Chemical Properties |
| Boiling point | 93 °C | | density | 1.12g/ml | | refractive index | 1.5420-1.5460 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | clear liquid | | pka | 4.04±0.10(Predicted) | | color | Light orange to Yellow to Green | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C4H7N3/c1-7-3-2-4(5)6-7/h2-3H,1H3,(H2,5,6) | | InChIKey | MOGQNVSKBCVIPW-UHFFFAOYSA-N | | SMILES | N1(C)C=CC(N)=N1 | | CAS DataBase Reference | 1904-31-0(CAS DataBase Reference) | | NIST Chemistry Reference | 1-methyl-3-aminopyrazole(1904-31-0) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN2735 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HazardClass | 8 | | HS Code | 29331990 | | Storage Class | 11 - Combustible Solids |
| | 1-Methyl-1H-pyrazol-3-amine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | 1-Methyl-1H-pyrazol-3-amine Preparation Products And Raw materials |
|