| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | (2-(Methylthio)pyriMidin-4-yl)Methanol Basic information |
| Product Name: | (2-(Methylthio)pyriMidin-4-yl)Methanol | | Synonyms: | (2-(Methylthio)pyriMidin-4-yl)Methanol;2-(methylthio)-4-Pyrimidinemethanol;4-Pyrimidinemethanol, 2-(methylthio)-;2-(Methylthio)-4-pyrimidinyl]methanol;(2-(methylmercaptoyl)pyrimidine-4-yl)methylol;(2-methylsulfanylpyrimidin-4-yl)methanol | | CAS: | 102921-92-6 | | MF: | C6H8N2OS | | MW: | 156.21 | | EINECS: | | | Product Categories: | | | Mol File: | 102921-92-6.mol |  |
| | (2-(Methylthio)pyriMidin-4-yl)Methanol Chemical Properties |
| Boiling point | 322.8±17.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.19±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C6H8N2OS/c1-10-6-7-3-2-5(4-9)8-6/h2-3,9H,4H2,1H3 | | InChIKey | NTKSOHDODBYGFL-UHFFFAOYSA-N | | SMILES | C1(SC)=NC=CC(CO)=N1 |
| | (2-(Methylthio)pyriMidin-4-yl)Methanol Usage And Synthesis |
| | (2-(Methylthio)pyriMidin-4-yl)Methanol Preparation Products And Raw materials |
|